C13H9F2NO4S — CID 26951283
N-(1,3-benzodioxol-5-yl)-3,5-difluorobenzenesulfonamide (PubChem CID 26951283) has the molecular formula C13H9F2NO4S and a molecular weight of 313.28 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3,5-difluorobenzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 26951283 |
| Molecular Formula | C13H9F2NO4S |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3,5-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)OCO2)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H9F2NO4S/c14-8-3-9(15)5-11(4-8)21(17,18)16-10-1-2-12-13(6-10)20-7-19-12/h1-6,16H,7H2 |
| InChIKey | KCBHXJORCLXNPN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |