C12H9ClN2O4S — CID 61003220
N-(1,3-benzodioxol-5-yl)-2-chloropyridine-4-sulfonamide (PubChem CID 61003220) has the molecular formula C12H9ClN2O4S and a molecular weight of 312.73 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-chloropyridine-4-sulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-chloropyridine-4-sulfonamide |
|---|---|
| PubChem CID | 61003220 |
| Molecular Formula | C12H9ClN2O4S |
| Molecular Weight | 312.73 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-chloropyridine-4-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)OCO2)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C12H9ClN2O4S/c13-12-6-9(3-4-14-12)20(16,17)15-8-1-2-10-11(5-8)19-7-18-10/h1-6,15H,7H2 |
| InChIKey | AGEBADJIAYYISC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.73 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|