C12H8ClN3O4S — CID 61051650
2-chloro-N-(2-oxo-3H-1,3-benzoxazol-5-yl)pyridine-4-sulfonamide (PubChem CID 61051650) has the molecular formula C12H8ClN3O4S and a molecular weight of 325.73 g/mol. Its IUPAC name is 2-chloro-N-(2-oxo-3H-1,3-benzoxazol-5-yl)pyridine-4-sulfonamide.
| Compound Name | 2-chloro-N-(2-oxo-3H-1,3-benzoxazol-5-yl)pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 61051650 |
| Molecular Formula | C12H8ClN3O4S |
| Molecular Weight | 325.73 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 2-chloro-N-(2-oxo-3H-1,3-benzoxazol-5-yl)pyridine-4-sulfonamide |
| SMILES | O=c1[nH]c2cc(NS(=O)(=O)c3ccnc(Cl)c3)ccc2o1 |
| InChI | InChI=1S/C12H8ClN3O4S/c13-11-6-8(3-4-14-11)21(18,19)16-7-1-2-10-9(5-7)15-12(17)20-10/h1-6,16H,(H,15,17) |
| InChIKey | BXEGSONPJJCYEE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.73 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|