C10H11ClN2O4S — CID 54877723
3-chloro-N-(2-oxo-3H-1,3-benzoxazol-5-yl)propane-1-sulfonamide (PubChem CID 54877723) has the molecular formula C10H11ClN2O4S and a molecular weight of 290.73 g/mol. Its IUPAC name is 3-chloro-N-(2-oxo-3H-1,3-benzoxazol-5-yl)propane-1-sulfonamide.
| Compound Name | 3-chloro-N-(2-oxo-3H-1,3-benzoxazol-5-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 54877723 |
| Molecular Formula | C10H11ClN2O4S |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 3-chloro-N-(2-oxo-3H-1,3-benzoxazol-5-yl)propane-1-sulfonamide |
| SMILES | O=c1[nH]c2cc(NS(=O)(=O)CCCCl)ccc2o1 |
| InChI | InChI=1S/C10H11ClN2O4S/c11-4-1-5-18(15,16)13-7-2-3-9-8(6-7)12-10(14)17-9/h2-3,6,13H,1,4-5H2,(H,12,14) |
| InChIKey | ZIMFTNBEQLYSEV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|