C13H16N2O5S — CID 154838414
1-(oxan-2-yl)-N-(2-oxo-3H-1,3-benzoxazol-5-yl)methanesulfonamide (PubChem CID 154838414) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is 1-(oxan-2-yl)-N-(2-oxo-3H-1,3-benzoxazol-5-yl)methanesulfonamide.
| Compound Name | 1-(oxan-2-yl)-N-(2-oxo-3H-1,3-benzoxazol-5-yl)methanesulfonamide |
|---|---|
| PubChem CID | 154838414 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1-(oxan-2-yl)-N-(2-oxo-3H-1,3-benzoxazol-5-yl)methanesulfonamide |
| SMILES | O=c1[nH]c2cc(NS(=O)(=O)CC3CCCCO3)ccc2o1 |
| InChI | InChI=1S/C13H16N2O5S/c16-13-14-11-7-9(4-5-12(11)20-13)15-21(17,18)8-10-3-1-2-6-19-10/h4-5,7,10,15H,1-3,6,8H2,(H,14,16) |
| InChIKey | YOVJNNHUEICBDY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |