C12H16ClNO3S — CID 65033474
N-[3-(chloromethyl)phenyl]-1-(oxolan-2-yl)methanesulfonamide (PubChem CID 65033474) has the molecular formula C12H16ClNO3S and a molecular weight of 289.78 g/mol. Its IUPAC name is N-[3-(chloromethyl)phenyl]-1-(oxolan-2-yl)methanesulfonamide.
| Compound Name | N-[3-(chloromethyl)phenyl]-1-(oxolan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 65033474 |
| Molecular Formula | C12H16ClNO3S |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | N-[3-(chloromethyl)phenyl]-1-(oxolan-2-yl)methanesulfonamide |
| SMILES | O=S(=O)(CC1CCCO1)Nc1cccc(CCl)c1 |
| InChI | InChI=1S/C12H16ClNO3S/c13-8-10-3-1-4-11(7-10)14-18(15,16)9-12-5-2-6-17-12/h1,3-4,7,12,14H,2,5-6,8-9H2 |
| InChIKey | AJUUHFAXMBCRHU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|