C15H24N2O3S — CID 106911397
1-(oxolan-2-yl)-N-[3-[(propan-2-ylamino)methyl]phenyl]methanesulfonamide (PubChem CID 106911397) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-(oxolan-2-yl)-N-[3-[(propan-2-ylamino)methyl]phenyl]methanesulfonamide.
| Compound Name | 1-(oxolan-2-yl)-N-[3-[(propan-2-ylamino)methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 106911397 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 1-(oxolan-2-yl)-N-[3-[(propan-2-ylamino)methyl]phenyl]methanesulfonamide |
| SMILES | CC(C)NCc1cccc(NS(=O)(=O)CC2CCCO2)c1 |
| InChI | InChI=1S/C15H24N2O3S/c1-12(2)16-10-13-5-3-6-14(9-13)17-21(18,19)11-15-7-4-8-20-15/h3,5-6,9,12,15-17H,4,7-8,10-11H2,1-2H3 |
| InChIKey | BTLCEYXCXKKAEV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |