C12H14N2O3S — CID 63247332
N-(3-cyanophenyl)-1-(oxolan-2-yl)methanesulfonamide (PubChem CID 63247332) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is N-(3-cyanophenyl)-1-(oxolan-2-yl)methanesulfonamide.
| Compound Name | N-(3-cyanophenyl)-1-(oxolan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 63247332 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | N-(3-cyanophenyl)-1-(oxolan-2-yl)methanesulfonamide |
| SMILES | N#Cc1cccc(NS(=O)(=O)CC2CCCO2)c1 |
| InChI | InChI=1S/C12H14N2O3S/c13-8-10-3-1-4-11(7-10)14-18(15,16)9-12-5-2-6-17-12/h1,3-4,7,12,14H,2,5-6,9H2 |
| InChIKey | LNOUVWLHXPDAHV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |