C13H16N2O3S — CID 63246993
N-(5-cyano-2-methylphenyl)-1-(oxolan-2-yl)methanesulfonamide (PubChem CID 63246993) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is N-(5-cyano-2-methylphenyl)-1-(oxolan-2-yl)methanesulfonamide.
| Compound Name | N-(5-cyano-2-methylphenyl)-1-(oxolan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 63246993 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | N-(5-cyano-2-methylphenyl)-1-(oxolan-2-yl)methanesulfonamide |
| SMILES | Cc1ccc(C#N)cc1NS(=O)(=O)CC1CCCO1 |
| InChI | InChI=1S/C13H16N2O3S/c1-10-4-5-11(8-14)7-13(10)15-19(16,17)9-12-3-2-6-18-12/h4-5,7,12,15H,2-3,6,9H2,1H3 |
| InChIKey | MACDJDIXCTZFRV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |