C14H18N2O2 — CID 93275329
5-[[(1S,2R)-2-methylcyclohexyl]amino]-3H-1,3-benzoxazol-2-one (PubChem CID 93275329) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 5-[[(1S,2R)-2-methylcyclohexyl]amino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[[(1S,2R)-2-methylcyclohexyl]amino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 93275329 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 5-[[(1S,2R)-2-methylcyclohexyl]amino]-3H-1,3-benzoxazol-2-one |
| SMILES | C[C@@H]1CCCC[C@@H]1Nc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C14H18N2O2/c1-9-4-2-3-5-11(9)15-10-6-7-13-12(8-10)16-14(17)18-13/h6-9,11,15H,2-5H2,1H3,(H,16,17)/t9-,11+/m1/s1 |
| InChIKey | OPEMDSCICSPEED-KOLCDFICSA-N |
| XLogP | 3.11 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |