C13H16N2O2 — CID 113489813
5-(1-cyclopropylpropan-2-ylamino)-3H-1,3-benzoxazol-2-one (PubChem CID 113489813) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 5-(1-cyclopropylpropan-2-ylamino)-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-(1-cyclopropylpropan-2-ylamino)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 113489813 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 5-(1-cyclopropylpropan-2-ylamino)-3H-1,3-benzoxazol-2-one |
| SMILES | CC(CC1CC1)Nc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C13H16N2O2/c1-8(6-9-2-3-9)14-10-4-5-12-11(7-10)15-13(16)17-12/h4-5,7-9,14H,2-3,6H2,1H3,(H,15,16) |
| InChIKey | OSFGQGKKGIGTEH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |