C14H20N2O2 — CID 112743200
5-(2,4-dimethylpentan-3-ylamino)-3H-1,3-benzoxazol-2-one (PubChem CID 112743200) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 5-(2,4-dimethylpentan-3-ylamino)-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-(2,4-dimethylpentan-3-ylamino)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 112743200 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 5-(2,4-dimethylpentan-3-ylamino)-3H-1,3-benzoxazol-2-one |
| SMILES | CC(C)C(Nc1ccc2oc(=O)[nH]c2c1)C(C)C |
| InChI | InChI=1S/C14H20N2O2/c1-8(2)13(9(3)4)15-10-5-6-12-11(7-10)16-14(17)18-12/h5-9,13,15H,1-4H3,(H,16,17) |
| InChIKey | OCKHCQQAHHGBDH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |