C12H15N3O3 — CID 43710360
2-amino-3-methyl-N-(2-oxo-3H-1,3-benzoxazol-5-yl)butanamide (PubChem CID 43710360) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-amino-3-methyl-N-(2-oxo-3H-1,3-benzoxazol-5-yl)butanamide.
| Compound Name | 2-amino-3-methyl-N-(2-oxo-3H-1,3-benzoxazol-5-yl)butanamide |
|---|---|
| PubChem CID | 43710360 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 2-amino-3-methyl-N-(2-oxo-3H-1,3-benzoxazol-5-yl)butanamide |
| SMILES | CC(C)C(N)C(=O)Nc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C12H15N3O3/c1-6(2)10(13)11(16)14-7-3-4-9-8(5-7)15-12(17)18-9/h3-6,10H,13H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | CJSYGYBPMNTLQJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 101.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |