C11H11N3O5 — CID 115180967
2-amino-4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid (PubChem CID 115180967) has the molecular formula C11H11N3O5 and a molecular weight of 265.23 g/mol. Its IUPAC name is 2-amino-4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid.
| Compound Name | 2-amino-4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 115180967 |
| Molecular Formula | C11H11N3O5 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-amino-4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid |
| SMILES | NC(CC(=O)Nc1ccc2oc(=O)[nH]c2c1)C(=O)O |
| InChI | InChI=1S/C11H11N3O5/c12-6(10(16)17)4-9(15)13-5-1-2-8-7(3-5)14-11(18)19-8/h1-3,6H,4,12H2,(H,13,15)(H,14,18)(H,16,17) |
| InChIKey | ZUGGCRBSATZEMX-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 138.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |