4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid

C11H10N2O5 — CID 12925401

IUPAC4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid
SMILESO=C(O)CCC(=O)Nc1ccc2oc(=O)[nH]c2c1
InChIInChI=1S/C11H10N2O5/c14-9(3-4-10(15)16)12-6-1-2-8-7(5-6)13-11(17)18-8/h1-2,5H,3-4H2,(H,12,14)(H,13,17)(H,15,16)
InChIKeyNFHJFXLZWMEDQN-UHFFFAOYSA-N
MW250.21 g/mol
LogP0.92
Rot. Bonds4

About 4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid

4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid (PubChem CID 12925401) has the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. Its IUPAC name is 4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid.

Molecular Properties

Compound Name4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid
PubChem CID12925401
Molecular FormulaC11H10N2O5
Molecular Weight250.21 g/mol
Exact Mass250.06
IUPAC Name4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid
SMILESO=C(O)CCC(=O)Nc1ccc2oc(=O)[nH]c2c1
InChIInChI=1S/C11H10N2O5/c14-9(3-4-10(15)16)12-6-1-2-8-7(5-6)13-11(17)18-8/h1-2,5H,3-4H2,(H,12,14)(H,13,17)(H,15,16)
InChIKeyNFHJFXLZWMEDQN-UHFFFAOYSA-N
XLogP0.92
TPSA112.40 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.21
LogP ≤ 50.92
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid?
The IUPAC name of 4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid (CID 12925401) is 4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid.
What is the SMILES notation for 4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid?
The canonical SMILES for 4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid is O=C(O)CCC(=O)Nc1ccc2oc(=O)[nH]c2c1.
What is the InChIKey of 4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid?
The InChIKey is NFHJFXLZWMEDQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O5/c14-9(3-4-10(15)16)12-6-1-2-8-7(5-6)13-11(17)18-8/h1-2,5H,3-4H2,(H,12,14)(H,13,17)(H,15,16).
What are the key properties of 4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid?
4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid has a molecular weight of 250.21 g/mol, XLogP of 0.92, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]butanoic acid is sourced from PubChem (CID 12925401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).