C12H12N2O5 — CID 82501414
4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)methylamino]butanoic acid (PubChem CID 82501414) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is 4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)methylamino]butanoic acid.
| Compound Name | 4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 82501414 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 4-oxo-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)methylamino]butanoic acid |
| SMILES | O=C(O)CCC(=O)NCc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C12H12N2O5/c15-10(3-4-11(16)17)13-6-7-1-2-9-8(5-7)14-12(18)19-9/h1-2,5H,3-4,6H2,(H,13,15)(H,14,18)(H,16,17) |
| InChIKey | VHZUXZIKQBGJRY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |