C14H18N2O3 — CID 110786713
2-ethyl-N-[(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanamide (PubChem CID 110786713) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-ethyl-N-[(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanamide.
| Compound Name | 2-ethyl-N-[(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanamide |
|---|---|
| PubChem CID | 110786713 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-ethyl-N-[(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanamide |
| SMILES | CCC(CC)C(=O)NCc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C14H18N2O3/c1-3-10(4-2)13(17)15-8-9-5-6-12-11(7-9)16-14(18)19-12/h5-7,10H,3-4,8H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | NCUBPQRAXFCGMJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |