C15H10Cl2N2O3 — CID 110786732
3,4-dichloro-N-[(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]benzamide (PubChem CID 110786732) has the molecular formula C15H10Cl2N2O3 and a molecular weight of 337.16 g/mol. Its IUPAC name is 3,4-dichloro-N-[(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]benzamide.
| Compound Name | 3,4-dichloro-N-[(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 110786732 |
| Molecular Formula | C15H10Cl2N2O3 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 3,4-dichloro-N-[(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]benzamide |
| SMILES | O=C(NCc1ccc2oc(=O)[nH]c2c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H10Cl2N2O3/c16-10-3-2-9(6-11(10)17)14(20)18-7-8-1-4-13-12(5-8)19-15(21)22-13/h1-6H,7H2,(H,18,20)(H,19,21) |
| InChIKey | WMDOUNVODATLHD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |