C15H13N3O5S — CID 110766627
2-oxo-N-[(4-sulfamoylphenyl)methyl]-3H-1,3-benzoxazole-5-carboxamide (PubChem CID 110766627) has the molecular formula C15H13N3O5S and a molecular weight of 347.35 g/mol. Its IUPAC name is 2-oxo-N-[(4-sulfamoylphenyl)methyl]-3H-1,3-benzoxazole-5-carboxamide.
| Compound Name | 2-oxo-N-[(4-sulfamoylphenyl)methyl]-3H-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 110766627 |
| Molecular Formula | C15H13N3O5S |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2-oxo-N-[(4-sulfamoylphenyl)methyl]-3H-1,3-benzoxazole-5-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)c2ccc3oc(=O)[nH]c3c2)cc1 |
| InChI | InChI=1S/C15H13N3O5S/c16-24(21,22)11-4-1-9(2-5-11)8-17-14(19)10-3-6-13-12(7-10)18-15(20)23-13/h1-7H,8H2,(H,17,19)(H,18,20)(H2,16,21,22) |
| InChIKey | MBBIISNQVBVBJX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 135.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |