C8H7N3O3 — CID 116843327
2-oxo-3H-1,3-benzoxazole-5-carbohydrazide (PubChem CID 116843327) has the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. Its IUPAC name is 2-oxo-3H-1,3-benzoxazole-5-carbohydrazide.
| Compound Name | 2-oxo-3H-1,3-benzoxazole-5-carbohydrazide |
|---|---|
| PubChem CID | 116843327 |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 2-oxo-3H-1,3-benzoxazole-5-carbohydrazide |
| SMILES | NNC(=O)c1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C8H7N3O3/c9-11-7(12)4-1-2-6-5(3-4)10-8(13)14-6/h1-3H,9H2,(H,10,13)(H,11,12) |
| InChIKey | VOSFBKNXWKSIGS-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 101.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|