C21H15N3O4 — CID 38468547
4-benzamido-N-(2-oxo-3H-1,3-benzoxazol-5-yl)benzamide (PubChem CID 38468547) has the molecular formula C21H15N3O4 and a molecular weight of 373.37 g/mol. Its IUPAC name is 4-benzamido-N-(2-oxo-3H-1,3-benzoxazol-5-yl)benzamide.
| Compound Name | 4-benzamido-N-(2-oxo-3H-1,3-benzoxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 38468547 |
| Molecular Formula | C21H15N3O4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 4-benzamido-N-(2-oxo-3H-1,3-benzoxazol-5-yl)benzamide |
| SMILES | O=C(Nc1ccc(C(=O)Nc2ccc3oc(=O)[nH]c3c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H15N3O4/c25-19(13-4-2-1-3-5-13)22-15-8-6-14(7-9-15)20(26)23-16-10-11-18-17(12-16)24-21(27)28-18/h1-12H,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | NBTMZOYSOVRDHY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 104.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |