C13H9N3O4 — CID 38466723
1-oxido-N-(2-oxo-3H-1,3-benzoxazol-5-yl)pyridin-1-ium-4-carboxamide (PubChem CID 38466723) has the molecular formula C13H9N3O4 and a molecular weight of 271.23 g/mol. Its IUPAC name is 1-oxido-N-(2-oxo-3H-1,3-benzoxazol-5-yl)pyridin-1-ium-4-carboxamide.
| Compound Name | 1-oxido-N-(2-oxo-3H-1,3-benzoxazol-5-yl)pyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 38466723 |
| Molecular Formula | C13H9N3O4 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 1-oxido-N-(2-oxo-3H-1,3-benzoxazol-5-yl)pyridin-1-ium-4-carboxamide |
| SMILES | O=C(Nc1ccc2oc(=O)[nH]c2c1)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C13H9N3O4/c17-12(8-3-5-16(19)6-4-8)14-9-1-2-11-10(7-9)15-13(18)20-11/h1-7H,(H,14,17)(H,15,18) |
| InChIKey | WVVNKXVJPAYAHK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|