C18H13N3O3 — CID 38467191
N-(2-oxo-3H-1,3-benzoxazol-5-yl)-4-pyrrol-1-ylbenzamide (PubChem CID 38467191) has the molecular formula C18H13N3O3 and a molecular weight of 319.32 g/mol. Its IUPAC name is N-(2-oxo-3H-1,3-benzoxazol-5-yl)-4-pyrrol-1-ylbenzamide.
| Compound Name | N-(2-oxo-3H-1,3-benzoxazol-5-yl)-4-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 38467191 |
| Molecular Formula | C18H13N3O3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-(2-oxo-3H-1,3-benzoxazol-5-yl)-4-pyrrol-1-ylbenzamide |
| SMILES | O=C(Nc1ccc2oc(=O)[nH]c2c1)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C18H13N3O3/c22-17(12-3-6-14(7-4-12)21-9-1-2-10-21)19-13-5-8-16-15(11-13)20-18(23)24-16/h1-11H,(H,19,22)(H,20,23) |
| InChIKey | DRKCYUYOGRKDEG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 80.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |