C15H12N2O5S — CID 37095710
3-methylsulfonyl-N-(2-oxo-3H-1,3-benzoxazol-5-yl)benzamide (PubChem CID 37095710) has the molecular formula C15H12N2O5S and a molecular weight of 332.34 g/mol. Its IUPAC name is 3-methylsulfonyl-N-(2-oxo-3H-1,3-benzoxazol-5-yl)benzamide.
| Compound Name | 3-methylsulfonyl-N-(2-oxo-3H-1,3-benzoxazol-5-yl)benzamide |
|---|---|
| PubChem CID | 37095710 |
| Molecular Formula | C15H12N2O5S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 3-methylsulfonyl-N-(2-oxo-3H-1,3-benzoxazol-5-yl)benzamide |
| SMILES | CS(=O)(=O)c1cccc(C(=O)Nc2ccc3oc(=O)[nH]c3c2)c1 |
| InChI | InChI=1S/C15H12N2O5S/c1-23(20,21)11-4-2-3-9(7-11)14(18)16-10-5-6-13-12(8-10)17-15(19)22-13/h2-8H,1H3,(H,16,18)(H,17,19) |
| InChIKey | BXVFFBFDOGOEMO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |