C13H11N3O3 — CID 134020024
1-methyl-N-(2-oxo-3H-1,3-benzoxazol-5-yl)pyrrole-2-carboxamide (PubChem CID 134020024) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is 1-methyl-N-(2-oxo-3H-1,3-benzoxazol-5-yl)pyrrole-2-carboxamide.
| Compound Name | 1-methyl-N-(2-oxo-3H-1,3-benzoxazol-5-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 134020024 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 1-methyl-N-(2-oxo-3H-1,3-benzoxazol-5-yl)pyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)Nc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C13H11N3O3/c1-16-6-2-3-10(16)12(17)14-8-4-5-11-9(7-8)15-13(18)19-11/h2-7H,1H3,(H,14,17)(H,15,18) |
| InChIKey | RVIUYKMMNBXMIP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 80.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |