C18H12N2O3S — CID 134019850
N-(2-oxo-3H-1,3-benzoxazol-5-yl)-3-phenylthiophene-2-carboxamide (PubChem CID 134019850) has the molecular formula C18H12N2O3S and a molecular weight of 336.37 g/mol. Its IUPAC name is N-(2-oxo-3H-1,3-benzoxazol-5-yl)-3-phenylthiophene-2-carboxamide.
| Compound Name | N-(2-oxo-3H-1,3-benzoxazol-5-yl)-3-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 134019850 |
| Molecular Formula | C18H12N2O3S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | N-(2-oxo-3H-1,3-benzoxazol-5-yl)-3-phenylthiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc2oc(=O)[nH]c2c1)c1sccc1-c1ccccc1 |
| InChI | InChI=1S/C18H12N2O3S/c21-17(16-13(8-9-24-16)11-4-2-1-3-5-11)19-12-6-7-15-14(10-12)20-18(22)23-15/h1-10H,(H,19,21)(H,20,22) |
| InChIKey | INHBMEGKBVEEFQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |