C13H11N3O3S — CID 115286345
2-amino-N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-thiophen-2-ylacetamide (PubChem CID 115286345) has the molecular formula C13H11N3O3S and a molecular weight of 289.32 g/mol. Its IUPAC name is 2-amino-N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-thiophen-2-ylacetamide.
| Compound Name | 2-amino-N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 115286345 |
| Molecular Formula | C13H11N3O3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 2-amino-N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-thiophen-2-ylacetamide |
| SMILES | NC(C(=O)Nc1ccc2oc(=O)[nH]c2c1)c1cccs1 |
| InChI | InChI=1S/C13H11N3O3S/c14-11(10-2-1-5-20-10)12(17)15-7-3-4-9-8(6-7)16-13(18)19-9/h1-6,11H,14H2,(H,15,17)(H,16,18) |
| InChIKey | PJMRKPQMBRFZPW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 101.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |