C14H13N3O2S — CID 115286986
2-amino-N-(2-methyl-1,3-benzoxazol-5-yl)-2-thiophen-2-ylacetamide (PubChem CID 115286986) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-amino-N-(2-methyl-1,3-benzoxazol-5-yl)-2-thiophen-2-ylacetamide.
| Compound Name | 2-amino-N-(2-methyl-1,3-benzoxazol-5-yl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 115286986 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-amino-N-(2-methyl-1,3-benzoxazol-5-yl)-2-thiophen-2-ylacetamide |
| SMILES | Cc1nc2cc(NC(=O)C(N)c3cccs3)ccc2o1 |
| InChI | InChI=1S/C14H13N3O2S/c1-8-16-10-7-9(4-5-11(10)19-8)17-14(18)13(15)12-3-2-6-20-12/h2-7,13H,15H2,1H3,(H,17,18) |
| InChIKey | RCTOAHPBWSYTAG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |