C17H17N3O3S — CID 35626706
N-[4-[(2-methyl-1,3-benzoxazol-5-yl)amino]-4-oxobutyl]thiophene-2-carboxamide (PubChem CID 35626706) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is N-[4-[(2-methyl-1,3-benzoxazol-5-yl)amino]-4-oxobutyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(2-methyl-1,3-benzoxazol-5-yl)amino]-4-oxobutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 35626706 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-[4-[(2-methyl-1,3-benzoxazol-5-yl)amino]-4-oxobutyl]thiophene-2-carboxamide |
| SMILES | Cc1nc2cc(NC(=O)CCCNC(=O)c3cccs3)ccc2o1 |
| InChI | InChI=1S/C17H17N3O3S/c1-11-19-13-10-12(6-7-14(13)23-11)20-16(21)5-2-8-18-17(22)15-4-3-9-24-15/h3-4,6-7,9-10H,2,5,8H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | KNUKAGHPFMHMBS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|