C18H21N3O5S — CID 55745271
N-[4-[3-(2-amino-2-oxoethoxy)-4-methoxyanilino]-4-oxobutyl]thiophene-2-carboxamide (PubChem CID 55745271) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is N-[4-[3-(2-amino-2-oxoethoxy)-4-methoxyanilino]-4-oxobutyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[3-(2-amino-2-oxoethoxy)-4-methoxyanilino]-4-oxobutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55745271 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-[4-[3-(2-amino-2-oxoethoxy)-4-methoxyanilino]-4-oxobutyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)CCCNC(=O)c2cccs2)cc1OCC(N)=O |
| InChI | InChI=1S/C18H21N3O5S/c1-25-13-7-6-12(10-14(13)26-11-16(19)22)21-17(23)5-2-8-20-18(24)15-4-3-9-27-15/h3-4,6-7,9-10H,2,5,8,11H2,1H3,(H2,19,22)(H,20,24)(H,21,23) |
| InChIKey | DIZVNBKSWCINSN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|