C21H27N3O5S — CID 55654857
tert-butyl N-[2-methoxy-5-[4-(thiophene-2-carbonylamino)butanoylamino]phenyl]carbamate (PubChem CID 55654857) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is tert-butyl N-[2-methoxy-5-[4-(thiophene-2-carbonylamino)butanoylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-methoxy-5-[4-(thiophene-2-carbonylamino)butanoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 55654857 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | tert-butyl N-[2-methoxy-5-[4-(thiophene-2-carbonylamino)butanoylamino]phenyl]carbamate |
| SMILES | COc1ccc(NC(=O)CCCNC(=O)c2cccs2)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H27N3O5S/c1-21(2,3)29-20(27)24-15-13-14(9-10-16(15)28-4)23-18(25)8-5-11-22-19(26)17-7-6-12-30-17/h6-7,9-10,12-13H,5,8,11H2,1-4H3,(H,22,26)(H,23,25)(H,24,27) |
| InChIKey | PDDAFTJWUMVAOD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|