C17H23F3N2O5 — CID 55674089
tert-butyl N-[2-methoxy-5-[3-(2,2,2-trifluoroethoxy)propanoylamino]phenyl]carbamate (PubChem CID 55674089) has the molecular formula C17H23F3N2O5 and a molecular weight of 392.37 g/mol. Its IUPAC name is tert-butyl N-[2-methoxy-5-[3-(2,2,2-trifluoroethoxy)propanoylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-methoxy-5-[3-(2,2,2-trifluoroethoxy)propanoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 55674089 |
| Molecular Formula | C17H23F3N2O5 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | tert-butyl N-[2-methoxy-5-[3-(2,2,2-trifluoroethoxy)propanoylamino]phenyl]carbamate |
| SMILES | COc1ccc(NC(=O)CCOCC(F)(F)F)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23F3N2O5/c1-16(2,3)27-15(24)22-12-9-11(5-6-13(12)25-4)21-14(23)7-8-26-10-17(18,19)20/h5-6,9H,7-8,10H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | AGQWIYANPDHTFA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|