C21H27N3O6S — CID 55654417
tert-butyl N-[5-[[2-[benzenesulfonyl(methyl)amino]acetyl]amino]-2-methoxyphenyl]carbamate (PubChem CID 55654417) has the molecular formula C21H27N3O6S and a molecular weight of 449.53 g/mol. Its IUPAC name is tert-butyl N-[5-[[2-[benzenesulfonyl(methyl)amino]acetyl]amino]-2-methoxyphenyl]carbamate.
| Compound Name | tert-butyl N-[5-[[2-[benzenesulfonyl(methyl)amino]acetyl]amino]-2-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 55654417 |
| Molecular Formula | C21H27N3O6S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | tert-butyl N-[5-[[2-[benzenesulfonyl(methyl)amino]acetyl]amino]-2-methoxyphenyl]carbamate |
| SMILES | COc1ccc(NC(=O)CN(C)S(=O)(=O)c2ccccc2)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H27N3O6S/c1-21(2,3)30-20(26)23-17-13-15(11-12-18(17)29-5)22-19(25)14-24(4)31(27,28)16-9-7-6-8-10-16/h6-13H,14H2,1-5H3,(H,22,25)(H,23,26) |
| InChIKey | PVNOKXZWQKFOPD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |