C24H33N3O6S — CID 55654948
tert-butyl N-[5-[[5-(diethylsulfamoyl)-2-methylbenzoyl]amino]-2-methoxyphenyl]carbamate (PubChem CID 55654948) has the molecular formula C24H33N3O6S and a molecular weight of 491.61 g/mol. Its IUPAC name is tert-butyl N-[5-[[5-(diethylsulfamoyl)-2-methylbenzoyl]amino]-2-methoxyphenyl]carbamate.
| Compound Name | tert-butyl N-[5-[[5-(diethylsulfamoyl)-2-methylbenzoyl]amino]-2-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 55654948 |
| Molecular Formula | C24H33N3O6S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | tert-butyl N-[5-[[5-(diethylsulfamoyl)-2-methylbenzoyl]amino]-2-methoxyphenyl]carbamate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(C(=O)Nc2ccc(OC)c(NC(=O)OC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C24H33N3O6S/c1-8-27(9-2)34(30,31)18-12-10-16(3)19(15-18)22(28)25-17-11-13-21(32-7)20(14-17)26-23(29)33-24(4,5)6/h10-15H,8-9H2,1-7H3,(H,25,28)(H,26,29) |
| InChIKey | MUWLDMRZLRUZLC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |