C21H29N3O4S — CID 26505603
N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(2,5-dimethylanilino)acetamide (PubChem CID 26505603) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(2,5-dimethylanilino)acetamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(2,5-dimethylanilino)acetamide |
|---|---|
| PubChem CID | 26505603 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(2,5-dimethylanilino)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(NC(=O)CNc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C21H29N3O4S/c1-6-24(7-2)29(26,27)17-10-11-20(28-5)19(13-17)23-21(25)14-22-18-12-15(3)8-9-16(18)4/h8-13,22H,6-7,14H2,1-5H3,(H,23,25) |
| InChIKey | ASIQHMODIFLVCO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |