C22H29N3O5S — CID 17392379
methyl 3-[[2-[5-(diethylsulfamoyl)-2-methylanilino]acetyl]amino]-4-methylbenzoate (PubChem CID 17392379) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is methyl 3-[[2-[5-(diethylsulfamoyl)-2-methylanilino]acetyl]amino]-4-methylbenzoate.
| Compound Name | methyl 3-[[2-[5-(diethylsulfamoyl)-2-methylanilino]acetyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 17392379 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | methyl 3-[[2-[5-(diethylsulfamoyl)-2-methylanilino]acetyl]amino]-4-methylbenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(NCC(=O)Nc2cc(C(=O)OC)ccc2C)c1 |
| InChI | InChI=1S/C22H29N3O5S/c1-6-25(7-2)31(28,29)18-11-9-15(3)19(13-18)23-14-21(26)24-20-12-17(22(27)30-5)10-8-16(20)4/h8-13,23H,6-7,14H2,1-5H3,(H,24,26) |
| InChIKey | KKNQOUYMOUQNJG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |