C21H26FN3O5S — CID 46555537
5-(diethylsulfamoyl)-2-fluoro-N-[2-(2-methoxy-5-methylanilino)-2-oxoethyl]benzamide (PubChem CID 46555537) has the molecular formula C21H26FN3O5S and a molecular weight of 451.52 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-2-fluoro-N-[2-(2-methoxy-5-methylanilino)-2-oxoethyl]benzamide.
| Compound Name | 5-(diethylsulfamoyl)-2-fluoro-N-[2-(2-methoxy-5-methylanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 46555537 |
| Molecular Formula | C21H26FN3O5S |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 5-(diethylsulfamoyl)-2-fluoro-N-[2-(2-methoxy-5-methylanilino)-2-oxoethyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)NCC(=O)Nc2cc(C)ccc2OC)c1 |
| InChI | InChI=1S/C21H26FN3O5S/c1-5-25(6-2)31(28,29)15-8-9-17(22)16(12-15)21(27)23-13-20(26)24-18-11-14(3)7-10-19(18)30-4/h7-12H,5-6,13H2,1-4H3,(H,23,27)(H,24,26) |
| InChIKey | DDYPAGMMUFFGPQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |