C19H23Cl2N3O4S — CID 24510593
2-(2,5-dichloroanilino)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]acetamide (PubChem CID 24510593) has the molecular formula C19H23Cl2N3O4S and a molecular weight of 460.38 g/mol. Its IUPAC name is 2-(2,5-dichloroanilino)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]acetamide.
| Compound Name | 2-(2,5-dichloroanilino)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 24510593 |
| Molecular Formula | C19H23Cl2N3O4S |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 2-(2,5-dichloroanilino)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(NC(=O)CNc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C19H23Cl2N3O4S/c1-4-24(5-2)29(26,27)14-7-9-18(28-3)17(11-14)23-19(25)12-22-16-10-13(20)6-8-15(16)21/h6-11,22H,4-5,12H2,1-3H3,(H,23,25) |
| InChIKey | AWXQAPTWMNYNNN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |