C22H26ClN5O4S — CID 55918502
2-(5-chloro-2-pyrazol-1-ylanilino)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]acetamide (PubChem CID 55918502) has the molecular formula C22H26ClN5O4S and a molecular weight of 492.00 g/mol. Its IUPAC name is 2-(5-chloro-2-pyrazol-1-ylanilino)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]acetamide.
| Compound Name | 2-(5-chloro-2-pyrazol-1-ylanilino)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 55918502 |
| Molecular Formula | C22H26ClN5O4S |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 2-(5-chloro-2-pyrazol-1-ylanilino)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(NC(=O)CNc2cc(Cl)ccc2-n2cccn2)c1 |
| InChI | InChI=1S/C22H26ClN5O4S/c1-4-27(5-2)33(30,31)17-8-10-21(32-3)19(14-17)26-22(29)15-24-18-13-16(23)7-9-20(18)28-12-6-11-25-28/h6-14,24H,4-5,15H2,1-3H3,(H,26,29) |
| InChIKey | FPBRQQHPHFVFLG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |