C21H27N3O5S — CID 26243070
N-(5-acetamido-2-methoxyphenyl)-3-(diethylsulfamoyl)-4-methylbenzamide (PubChem CID 26243070) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is N-(5-acetamido-2-methoxyphenyl)-3-(diethylsulfamoyl)-4-methylbenzamide.
| Compound Name | N-(5-acetamido-2-methoxyphenyl)-3-(diethylsulfamoyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 26243070 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | N-(5-acetamido-2-methoxyphenyl)-3-(diethylsulfamoyl)-4-methylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)Nc2cc(NC(C)=O)ccc2OC)ccc1C |
| InChI | InChI=1S/C21H27N3O5S/c1-6-24(7-2)30(27,28)20-12-16(9-8-14(20)3)21(26)23-18-13-17(22-15(4)25)10-11-19(18)29-5/h8-13H,6-7H2,1-5H3,(H,22,25)(H,23,26) |
| InChIKey | GCVAFNAKQBROFS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |