C20H26N2O6S2 — CID 55613417
3-(diethylsulfamoyl)-N-(2-ethylsulfonylphenyl)-4-methoxybenzamide (PubChem CID 55613417) has the molecular formula C20H26N2O6S2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-(2-ethylsulfonylphenyl)-4-methoxybenzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-(2-ethylsulfonylphenyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 55613417 |
| Molecular Formula | C20H26N2O6S2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-(2-ethylsulfonylphenyl)-4-methoxybenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)Nc2ccccc2S(=O)(=O)CC)ccc1OC |
| InChI | InChI=1S/C20H26N2O6S2/c1-5-22(6-2)30(26,27)19-14-15(12-13-17(19)28-4)20(23)21-16-10-8-9-11-18(16)29(24,25)7-3/h8-14H,5-7H2,1-4H3,(H,21,23) |
| InChIKey | LRXVCXAMUYQJMH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |