C21H25N5O4S — CID 55856009
N-(1-benzyl-1,2,4-triazol-3-yl)-3-(diethylsulfamoyl)-4-methoxybenzamide (PubChem CID 55856009) has the molecular formula C21H25N5O4S and a molecular weight of 443.53 g/mol. Its IUPAC name is N-(1-benzyl-1,2,4-triazol-3-yl)-3-(diethylsulfamoyl)-4-methoxybenzamide.
| Compound Name | N-(1-benzyl-1,2,4-triazol-3-yl)-3-(diethylsulfamoyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 55856009 |
| Molecular Formula | C21H25N5O4S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | N-(1-benzyl-1,2,4-triazol-3-yl)-3-(diethylsulfamoyl)-4-methoxybenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)Nc2ncn(Cc3ccccc3)n2)ccc1OC |
| InChI | InChI=1S/C21H25N5O4S/c1-4-26(5-2)31(28,29)19-13-17(11-12-18(19)30-3)20(27)23-21-22-15-25(24-21)14-16-9-7-6-8-10-16/h6-13,15H,4-5,14H2,1-3H3,(H,23,24,27) |
| InChIKey | ADITZMZEUIEUHO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |