C18H17Cl2N5O3S — CID 5243844
N-(1-benzyl-1,2,4-triazol-3-yl)-2,4-dichloro-5-(dimethylsulfamoyl)benzamide (PubChem CID 5243844) has the molecular formula C18H17Cl2N5O3S and a molecular weight of 454.34 g/mol. Its IUPAC name is N-(1-benzyl-1,2,4-triazol-3-yl)-2,4-dichloro-5-(dimethylsulfamoyl)benzamide.
| Compound Name | N-(1-benzyl-1,2,4-triazol-3-yl)-2,4-dichloro-5-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 5243844 |
| Molecular Formula | C18H17Cl2N5O3S |
| Molecular Weight | 454.34 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | N-(1-benzyl-1,2,4-triazol-3-yl)-2,4-dichloro-5-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)Nc2ncn(Cc3ccccc3)n2)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H17Cl2N5O3S/c1-24(2)29(27,28)16-8-13(14(19)9-15(16)20)17(26)22-18-21-11-25(23-18)10-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3,(H,22,23,26) |
| InChIKey | HDNHJMIKQBKEJG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |