C20H20FN5O4S — CID 55856407
N-(1-benzyl-1,2,4-triazol-3-yl)-2-fluoro-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 55856407) has the molecular formula C20H20FN5O4S and a molecular weight of 445.48 g/mol. Its IUPAC name is N-(1-benzyl-1,2,4-triazol-3-yl)-2-fluoro-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(1-benzyl-1,2,4-triazol-3-yl)-2-fluoro-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55856407 |
| Molecular Formula | C20H20FN5O4S |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-(1-benzyl-1,2,4-triazol-3-yl)-2-fluoro-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(Nc1ncn(Cc2ccccc2)n1)c1cc(S(=O)(=O)N2CCOCC2)ccc1F |
| InChI | InChI=1S/C20H20FN5O4S/c21-18-7-6-16(31(28,29)26-8-10-30-11-9-26)12-17(18)19(27)23-20-22-14-25(24-20)13-15-4-2-1-3-5-15/h1-7,12,14H,8-11,13H2,(H,23,24,27) |
| InChIKey | SNLKBOGYJFOZSC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |