C29H32FN3O4S — CID 3352580
N-(1-benzylpiperidin-4-yl)-2-fluoro-5-morpholin-4-ylsulfonyl-N-phenylbenzamide (PubChem CID 3352580) has the molecular formula C29H32FN3O4S and a molecular weight of 537.66 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-fluoro-5-morpholin-4-ylsulfonyl-N-phenylbenzamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-fluoro-5-morpholin-4-ylsulfonyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 3352580 |
| Molecular Formula | C29H32FN3O4S |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-fluoro-5-morpholin-4-ylsulfonyl-N-phenylbenzamide |
| SMILES | O=C(c1cc(S(=O)(=O)N2CCOCC2)ccc1F)N(c1ccccc1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H32FN3O4S/c30-28-12-11-26(38(35,36)32-17-19-37-20-18-32)21-27(28)29(34)33(24-9-5-2-6-10-24)25-13-15-31(16-14-25)22-23-7-3-1-4-8-23/h1-12,21,25H,13-20,22H2 |
| InChIKey | QVSCURMOJVADFO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |