C20H21FN2O6S — CID 24643713
benzyl 2-[(2-fluoro-5-morpholin-4-ylsulfonylbenzoyl)amino]acetate (PubChem CID 24643713) has the molecular formula C20H21FN2O6S and a molecular weight of 436.46 g/mol. Its IUPAC name is benzyl 2-[(2-fluoro-5-morpholin-4-ylsulfonylbenzoyl)amino]acetate.
| Compound Name | benzyl 2-[(2-fluoro-5-morpholin-4-ylsulfonylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 24643713 |
| Molecular Formula | C20H21FN2O6S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | benzyl 2-[(2-fluoro-5-morpholin-4-ylsulfonylbenzoyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1F)OCc1ccccc1 |
| InChI | InChI=1S/C20H21FN2O6S/c21-18-7-6-16(30(26,27)23-8-10-28-11-9-23)12-17(18)20(25)22-13-19(24)29-14-15-4-2-1-3-5-15/h1-7,12H,8-11,13-14H2,(H,22,25) |
| InChIKey | IGUXOZNDZDPJOP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |