C19H18FNO6S — CID 2346722
phenacyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 2346722) has the molecular formula C19H18FNO6S and a molecular weight of 407.42 g/mol. Its IUPAC name is phenacyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | phenacyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2346722 |
| Molecular Formula | C19H18FNO6S |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | phenacyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1F)c1ccccc1 |
| InChI | InChI=1S/C19H18FNO6S/c20-17-7-6-15(28(24,25)21-8-10-26-11-9-21)12-16(17)19(23)27-13-18(22)14-4-2-1-3-5-14/h1-7,12H,8-11,13H2 |
| InChIKey | RCKGBJBZLNDOMD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |