C19H17FN2O5S — CID 2652352
(2-cyanophenyl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 2652352) has the molecular formula C19H17FN2O5S and a molecular weight of 404.42 g/mol. Its IUPAC name is (2-cyanophenyl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (2-cyanophenyl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2652352 |
| Molecular Formula | C19H17FN2O5S |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | (2-cyanophenyl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | N#Cc1ccccc1COC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1F |
| InChI | InChI=1S/C19H17FN2O5S/c20-18-6-5-16(28(24,25)22-7-9-26-10-8-22)11-17(18)19(23)27-13-15-4-2-1-3-14(15)12-21/h1-6,11H,7-10,13H2 |
| InChIKey | CTCPXCVYUIATBJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |