C20H19FN4O5S — CID 55453452
(4-aminoquinazolin-2-yl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 55453452) has the molecular formula C20H19FN4O5S and a molecular weight of 446.46 g/mol. Its IUPAC name is (4-aminoquinazolin-2-yl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (4-aminoquinazolin-2-yl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 55453452 |
| Molecular Formula | C20H19FN4O5S |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | (4-aminoquinazolin-2-yl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | Nc1nc(COC(=O)c2cc(S(=O)(=O)N3CCOCC3)ccc2F)nc2ccccc12 |
| InChI | InChI=1S/C20H19FN4O5S/c21-16-6-5-13(31(27,28)25-7-9-29-10-8-25)11-15(16)20(26)30-12-18-23-17-4-2-1-3-14(17)19(22)24-18/h1-6,11H,7-10,12H2,(H2,22,23,24) |
| InChIKey | QCASQCVEPKOXSZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |