C21H19FN2O6S — CID 16530508
(5-phenyl-1,3-oxazol-2-yl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 16530508) has the molecular formula C21H19FN2O6S and a molecular weight of 446.46 g/mol. Its IUPAC name is (5-phenyl-1,3-oxazol-2-yl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (5-phenyl-1,3-oxazol-2-yl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16530508 |
| Molecular Formula | C21H19FN2O6S |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | (5-phenyl-1,3-oxazol-2-yl)methyl 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(OCc1ncc(-c2ccccc2)o1)c1cc(S(=O)(=O)N2CCOCC2)ccc1F |
| InChI | InChI=1S/C21H19FN2O6S/c22-18-7-6-16(31(26,27)24-8-10-28-11-9-24)12-17(18)21(25)29-14-20-23-13-19(30-20)15-4-2-1-3-5-15/h1-7,12-13H,8-11,14H2 |
| InChIKey | IVKFXJVQTYVMHO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 98.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |